Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | N-Decyl-D-Gluconamide |
|---|---|
| Synonyms | (2R,3S,4R,5R)-N-Decyl-2,3,4,5,6-Pentahydroxy-Hexanamide; N-Decyl-D-Gluconamide |
| Molecular Structure |  |
| Molecular Formula | C16H33NO6 |
| Molecular Weight | 335.44 |
| CAS Registry Number | 18375-62-7 |
| EINECS | 242-255-2 |
| SMILES | [C@@H](CO)([C@H]([C@@H]([C@H](C(NCCCCCCCCCC)=O)O)O)O)O |
| InChI | 1S/C16H33NO6/c1-2-3-4-5-6-7-8-9-10-17-16(23)15(22)14(21)13(20)12(19)11-18/h12-15,18-22H,2-11H2,1H3,(H,17,23)/t12-,13-,14+,15-/m1/s1 |
| InChIKey | REISOHCMNXKYLD-APIJFGDWSA-N |
| Density | 1.166g/cm3 (Cal.) |
|---|---|
| Boiling point | 638.901°C at 760 mmHg (Cal.) |
| Flash point | 340.195°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Decyl-D-Gluconamide |