Online Database of Chemicals from Around the World
|
CAS#: 41444-55-7 Product: Decyl-D-Glucoside No suppilers available for the product. |
| Name | Decyl-D-Glucoside |
|---|---|
| Synonyms | (3R,4S,5S,6R)-2-Decoxy-6-(Hydroxymethyl)Tetrahydropyran-3,4,5-Triol; (3R,4S,5S,6R)-2-Decoxy-6-Methylol-Tetrahydropyran-3,4,5-Triol; D-Glucopyranoside, Decyl |
| Molecular Structure |  |
| Molecular Formula | C16H32O6 |
| Molecular Weight | 320.43 |
| CAS Registry Number | 41444-55-7 |
| SMILES | [C@@H]1(C(OCCCCCCCCCC)O[C@@H]([C@H]([C@@H]1O)O)CO)O |
| InChI | 1S/C16H32O6/c1-2-3-4-5-6-7-8-9-10-21-16-15(20)14(19)13(18)12(11-17)22-16/h12-20H,2-11H2,1H3/t12-,13-,14+,15-,16?/m1/s1 |
| InChIKey | JDRSMPFHFNXQRB-IWQYDBTJSA-N |
| Density | 1.15g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.538°C at 760 mmHg (Cal.) |
| Flash point | 242.002°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Decyl-D-Glucoside |