Online Database of Chemicals from Around the World
|
CAS#: 18383-49-8 Product: Carvone Oxide No suppilers available for the product. |
| Name | Carvone Oxide |
|---|---|
| Synonyms | (1R,4R,6R)-4-Isopropenyl-1-Methyl-7-Oxabicyclo[4.1.0]Heptan-2-One; C09841; Carvone Oxide |
| Molecular Structure |  |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 |
| CAS Registry Number | 18383-49-8 |
| SMILES | [C@]12(O[C@@H]1C[C@H](CC2=O)C(=C)C)C |
| InChI | 1S/C10H14O2/c1-6(2)7-4-8(11)10(3)9(5-7)12-10/h7,9H,1,4-5H2,2-3H3/t7-,9+,10-/m0/s1 |
| InChIKey | YGMNGQDLUQECTO-SFGNSQDASA-N |
| Density | 1.086g/cm3 (Cal.) |
|---|---|
| Boiling point | 255.579°C at 760 mmHg (Cal.) |
| Flash point | 107.574°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Carvone Oxide |