| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Enzalutamide Impurity B |
|---|---|
| Synonyms | 1,3-Bis(4-cyano-3-(trifluoromethyl)phenyl)thiourea |
| Molecular Structure | ![]() |
| Molecular Formula | C17H8F6N4S |
| Molecular Weight | 414.33 |
| CAS Registry Number | 1839619-50-9 |
| EC Number | 857-319-0 |
| SMILES | C1=CC(=C(C=C1NC(=S)NC2=CC(=C(C=C2)C#N)C(F)(F)F)C(F)(F)F)C#N |
| Density | 1.5±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.581, Calc.* |
| Boiling Point | 483.1±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 246.0±31.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H302+H312+H332-H315-H319 Details | ||||||||||||||||||||
| Safety Statements | P261-P271-P280-P302+P352-P305+P351+P338 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Enzalutamide Impurity B |