Online Database of Chemicals from Around the World
|
CAS#: 107807-24-9 Product: Epelmycin B No suppilers available for the product. |
| Name | Epelmycin B |
|---|---|
| Synonyms | Epelmycin B |
| Molecular Structure |  |
| Molecular Formula | C42H51NO16 |
| Molecular Weight | 825.86 |
| CAS Registry Number | 107807-24-9 |
| SMILES | C8=C7C(=O)C1=C(C(=C2C(=C1O)C(C(O)(CC2OC6OC(C(OC5OC(C4OC3OC(C(=O)CC3OC4C5)C)C)C(N(C)C)C6)C)CC)C(OC)=O)O)C(=O)C7=C(O)C=C8 |
| InChI | 1S/C42H51NO16/c1-8-42(51)15-25(29-30(33(42)40(50)52-7)37(49)31-32(36(29)48)35(47)28-19(34(31)46)10-9-11-21(28)44)57-26-12-20(43(5)6)38(17(3)53-26)58-27-14-23-39(18(4)54-27)59-41-24(56-23)13-22(45)16(2)55-41/h9-11,16-18,20,23-27,33,38-39,41,44,48-49,51H,8,12-15H2,1-7H3 |
| InChIKey | DKXGZTHFCJJLIP-UHFFFAOYSA-N |
| Density | 1.483g/cm3 (Cal.) |
|---|---|
| Boiling point | 860.204°C at 760 mmHg (Cal.) |
| Flash point | 474.034°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Epelmycin B |