Online Database of Chemicals from Around the World
|
CAS#: 18407-28-8 Product: Dibenzylsilanediol No suppilers available for the product. |
| Name | Dibenzylsilanediol |
|---|---|
| Synonyms | Bis(phenylmethyl)silanediol |
| Molecular Structure |  |
| Molecular Formula | C14H16O2Si |
| Molecular Weight | 244.36 |
| CAS Registry Number | 18407-28-8 |
| SMILES | O[Si](O)(Cc1ccccc1)Cc2ccccc2 |
| InChI | 1S/C14H16O2Si/c15-17(16,11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2 |
| InChIKey | IYFJDHOBSYWLAO-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.438°C at 760 mmHg (Cal.) |
| Flash point | 198.398°C (Cal.) |
| Refractive index | 1.589 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibenzylsilanediol |