Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Dibenzyl Succinate |
|---|---|
| Synonyms | Zinc02039079; Zinc02039082 |
| Molecular Structure |  |
| Molecular Formula | C4H8Br2O2 |
| Molecular Weight | 247.91 |
| CAS Registry Number | 20163-90-0 |
| SMILES | [C@H](Br)([C@@H](Br)CO)CO |
| InChI | 1S/C4H8Br2O2/c5-3(1-7)4(6)2-8/h3-4,7-8H,1-2H2/t3-,4+ |
| InChIKey | OXYNQEOLHRWEPE-ZXZARUISSA-N |
| Density | 2.124g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.427°C at 760 mmHg (Cal.) |
| Flash point | 156.637°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Dibenzyl Succinate |