| Axon MedChem BV | Netherlands | Inquire | ||
|---|---|---|---|---|
![]() |
+31 (50) 311-8007 | |||
![]() |
order@axonmedchem.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | R(-)-Propylnorapomorphine Hydrochloride |
|---|---|
| Synonyms | Lopac0_000435; (R)-6-Propyl-5,6,6A,7-Tetrahydro-4H-Dibenzo[De,G]Quinoline-10,11-Diol; Nchembio873-Comp5 |
| Molecular Structure | ![]() |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 |
| CAS Registry Number | 18426-20-5 |
| SMILES | [C@H]13N(CCC2=CC=CC(=C12)C4=C(C3)C=CC(=C4O)O)CCC |
| InChI | 1S/C19H21NO2/c1-2-9-20-10-8-12-4-3-5-14-17(12)15(20)11-13-6-7-16(21)19(22)18(13)14/h3-7,15,21-22H,2,8-11H2,1H3/t15-/m1/s1 |
| InChIKey | BTGAJCKRXPNBFI-OAHLLOKOSA-N |
| Density | 1.232g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.031°C at 760 mmHg (Cal.) |
| Flash point | 268.009°C (Cal.) |
| (1) | Diamandis et al.. Chemical genetics reveal a complex functional ground state of neural stem cells, Nature Chemical Biology, 2007 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for R(-)-Propylnorapomorphine Hydrochloride |