Online Database of Chemicals from Around the World
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 355-9920 | |||
 |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Vitas-M | Russian Federation | Inquire | ||
|---|---|---|---|---|
|
+7 (906) 781-2021 | |||
|
vitas@vitasmlab.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | Propyl 4-nitrobenzoate |
|---|---|
| Synonyms | 4-Nitrobenzoic Acid Propyl Ester; Benzoic Acid, 4-Nitro-, Propyl Ester; Benzoic Acid, P-Nitro-, Propyl Ester |
| Molecular Structure |  |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 |
| CAS Registry Number | 94-22-4 |
| SMILES | C1=CC(=CC=C1C(OCCC)=O)[N+]([O-])=O |
| InChI | 1S/C10H11NO4/c1-2-7-15-10(12)8-3-5-9(6-4-8)11(13)14/h3-6H,2,7H2,1H3 |
| InChIKey | KXUOYHZSTGGNCK-UHFFFAOYSA-N |
| Density | 1.215g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.079°C at 760 mmHg (Cal.) |
| Flash point | 148.06°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Propyl 4-nitrobenzoate |