|
CAS#: 18593-19-6 Product: Bis(2-Methylphenyl)Phosphinic Acid No suppilers available for the product. |
| Name | Bis(2-Methylphenyl)Phosphinic Acid |
|---|---|
| Synonyms | Bis(2-methylphenyl)phosphinic acid #; Phosphinic acid, bis(2-methylphenyl)-; Phosphinic acid, di-o-tolyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15O2P |
| Molecular Weight | 246.24 |
| CAS Registry Number | 18593-19-6 |
| SMILES | O=P(O)(c1ccccc1C)c2ccccc2C |
| InChI | 1S/C14H15O2P/c1-11-7-3-5-9-13(11)17(15,16)14-10-6-4-8-12(14)2/h3-10H,1-2H3,(H,15,16) |
| InChIKey | INPAGYCGPYZPII-UHFFFAOYSA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 469.199°C at 760 mmHg (Cal.) |
| Flash point | 237.563°C (Cal.) |
| Refractive index | 1.585 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(2-Methylphenyl)Phosphinic Acid |