Online Database of Chemicals from Around the World

Bis(4-methylphenyl)phosphoryl](mesityl)methanone
[CAS 270586-78-2]

List of Suppliers
Lift Chemical Technology Co., Ltd. China
www.liftchem.com
+86 (22) 8834-5196
sales@liftchem.com
Chemical distributor since 2023
chemBlink Standard supplier since 2023
Sinocure Chemical Group China
www.sinocurechem.com
+86 15550440621
info@sinocurechem.com
Chemical manufacturer since 2020

Identification
ClassificationChemical reagent >> Organic reagent >> Phosphine ligand
NameBis(4-methylphenyl)phosphoryl](mesityl)methanone
Molecular StructureBis(4-methylphenyl)phosphoryl](mesityl)methanone molecular structure (CAS 270586-78-2)
Molecular FormulaC24H25O2P
Molecular Weight376.43
CAS Registry Number270586-78-2
EC Number884-585-5
SMILESCc3cc(C)cc(C)c3C(=O)P(=O)(c1ccc(C)cc1)c2ccc(C)cc2
Properties
Density1.1±0.0 g/cm3, Calc.*
Index of Refraction1.590, Calc.*
Boiling Point538.8±0.0 °C (760 mmHg), Calc.*
Flash Point279.7±0.0 °C, Calc.*
*Calculated using Advanced Chemistry Development (ACD/Labs) Software.
Safety Data
Hazard Symbolssymbol symbol symbol   GHS07;GHS08;GHS09 Danger  Details
Risk StatementsH317-H360-H411  Details
Safety StatementsP201-P202-P261-P272-P273-P280-P302+P352-P308+P313-P333+P313-P391-P405-P501  Details
Transport InformationUN 3077
SDSAvailable
up Discovery and Applications
Bis(4-methylphenyl)phosphoryl](mesityl)methanone is a specialized chemical compound that has found its niche in the fields of organic chemistry and materials science. This compound, known for its unique chemical structure, has garnered attention due to its applications in various advanced technologies.

The synthesis of bis(4-methylphenyl)phosphoryl](mesityl)methanone involves the reaction of a phosphoryl chloride with a mesityl-containing ketone, resulting in a compound with a complex structure. The chemical formula of this substance highlights its composition: it contains two 4-methylphenyl groups and a mesityl group attached to a central methanone moiety, all coordinated with a phosphoryl group. This structure endows the compound with distinct properties that are leveraged in different scientific and industrial applications.

One of the primary applications of bis(4-methylphenyl)phosphoryl](mesityl)methanone is in the realm of materials science, particularly in the development of advanced polymers and materials with enhanced properties. The compound's phosphoryl group plays a crucial role in facilitating the polymerization process, contributing to the formation of polymers with improved thermal stability and chemical resistance. These properties make the resulting materials suitable for use in demanding environments, such as high-temperature industrial applications.

In the field of organic synthesis, bis(4-methylphenyl)phosphoryl](mesityl)methanone serves as an important reagent. It is used in the synthesis of various organic compounds, where its ability to act as a phosphorylating agent proves advantageous. This capability allows for the modification of other organic molecules, enabling the creation of new compounds with desired chemical characteristics. The versatility of this reagent in organic synthesis has made it a valuable tool for chemists working on complex synthetic pathways.

The compound also finds use in the development of specialty chemicals and additives. Its unique chemical structure can be employed to tailor the properties of these substances, such as enhancing their performance or stability. For example, bis(4-methylphenyl)phosphoryl](mesityl)methanone may be incorporated into formulations for coatings, adhesives, or other products where its chemical properties provide specific benefits.

Research into bis(4-methylphenyl)phosphoryl](mesityl)methanone continues to explore its potential applications and improve its synthesis. Ongoing studies aim to optimize its use in various chemical processes and materials, potentially expanding its applications in emerging technologies and industrial processes.

In summary, bis(4-methylphenyl)phosphoryl](mesityl)methanone is a compound with significant applications in materials science and organic synthesis. Its unique chemical structure and properties make it valuable for the development of advanced polymers, specialty chemicals, and as a reagent in organic synthesis. Continued research into this compound promises to uncover further applications and enhance its utility in various scientific and industrial fields.
Market Analysis Reports
Related Products
Bis(Methylpheny...  Bis(4-Methylphe...  Bis(2-Methylphe...  alpha,alpha-Bis...  2,3-Bis(4-Methy...  2,3-Bis(3-Methy...  Bis(2-Methylphe...  Bis(2-Methylphe...  2-{2-[Bis(2-Met...  P,P-Bis(3-Methy...  [Bis(2-methylph...  1,4-Bis(2-Methy...  N,N'-Bis(1-Meth...  N,N'-Bis(1-Meth...  N1,N3-Bis(2-Met...  1,3-Bis(4-Methy...  1,1-Bis(4-methy...  1,3-Bis(4-Methy...  1,3-Bis(2-methy...  1,3-Bis(3-methy...