Online Database of Chemicals from Around the World
|
CAS#: 18748-68-0 Product: Triphenyl(Trimethylstannyl)Silane No suppilers available for the product. |
| Name | Triphenyl(Trimethylstannyl)Silane |
|---|---|
| Synonyms | Trimethyl stannyl triphenyl silane; Trimethylstannyltriphenylsilane |
| Molecular Structure |  |
| Molecular Formula | C21H24SiSn |
| Molecular Weight | 423.21 |
| CAS Registry Number | 18748-68-0 |
| SMILES | C[Sn](C)(C)[Si](c1ccccc1)(c2ccccc2)c3ccccc3 |
| InChI | 1S/C18H15Si.3CH3.Sn/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;/h1-15H;3*1H3; |
| InChIKey | BJPWDJBFSGKETF-UHFFFAOYSA-N |
| Melting point | 119°C (Expl.) |
|---|---|
| Boiling point | 405.016°C at 760 mmHg (Cal.) |
| Flash point | 198.747°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Triphenyl(Trimethylstannyl)Silane |