Online Database of Chemicals from Around the World
|
CAS#: 33471-63-5 Product: 1,4,5-Tri(Phenyl)Triazole No suppilers available for the product. |
| Name | 1,4,5-Tri(Phenyl)Triazole |
|---|---|
| Synonyms | 1,4,5-Tri(Phenyl)-1,2,3-Triazole; 1H-1,2,3-Triazole, 1,4,5-Triphenyl-; Nsc127054 |
| Molecular Structure |  |
| Molecular Formula | C20H15N3 |
| Molecular Weight | 297.36 |
| CAS Registry Number | 33471-63-5 |
| SMILES | C4=CC=C(C1=C(N=N[N]1C2=CC=CC=C2)C3=CC=CC=C3)C=C4 |
| InChI | 1S/C20H15N3/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)23(22-21-19)18-14-8-3-9-15-18/h1-15H |
| InChIKey | NNPJRRDTJGOGFF-UHFFFAOYSA-N |
| Density | 1.141g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.5°C at 760 mmHg (Cal.) |
| Flash point | 238.35°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4,5-Tri(Phenyl)Triazole |