| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Name | 5-Acetyltaxachitriene A |
|---|---|
| Synonyms | (2,5,7,9,10,13-hexaacetyloxy-8,12,15,15-tetramethyl-4-bicyclo[9.3.1]pentadeca-3,8,11-trienyl)methyl acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C34H46O14 |
| Molecular Weight | 678.72 |
| CAS Registry Number | 187988-48-3 |
| SMILES | CC1=C2C(C(=C(C(CC(C(=CC(C(C2(C)C)CC1OC(=O)C)OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C)C)OC(=O)C)OC(=O)C |
| Density | 1.2±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.521, Calc.* |
| Boiling Point | 687.5±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 278.8±31.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 5-Acetyltaxachitriene A |