Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | N-Acetyltalosaminuronic acid |
|---|---|
| Synonyms | (2R,3S,4S,5R,6R)-5-Acetamido-3,4,6-Trihydroxy-Tetrahydropyran-2-Carboxylic Acid; (2R,3S,4S,5R,6R)-5-Acetamido-3,4,6-Trihydroxy-2-Tetrahydropyrancarboxylic Acid; (2R,3S,4S,5R,6R)-5-Acetamido-3,4,6-Trihydroxy-Oxane-2-Carboxylic Acid |
| Molecular Structure |  |
| Molecular Formula | C8H13NO7 |
| Molecular Weight | 235.19 |
| CAS Registry Number | 90319-06-5 |
| SMILES | [C@H]1(O)[C@@H]([C@H](O)[C@H](O)[C@@H](O1)C(=O)O)NC(=O)C |
| InChI | 1S/C8H13NO7/c1-2(10)9-3-4(11)5(12)6(7(13)14)16-8(3)15/h3-6,8,11-12,15H,1H3,(H,9,10)(H,13,14)/t3-,4+,5+,6-,8-/m1/s1 |
| InChIKey | KSOXQRPSZKLEOR-USOLSPIOSA-N |
| Density | 1.634g/cm3 (Cal.) |
|---|---|
| Boiling point | 679.161°C at 760 mmHg (Cal.) |
| Flash point | 364.544°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetyltalosaminuronic acid |