|
CAS#: 188-89-6 Product: Naphtho(8,1,2-bcd)Perylene No suppilers available for the product. |
| Name | Naphtho(8,1,2-bcd)Perylene |
|---|---|
| Synonyms | Naphtho[8,1,2-Bcd]Perylene |
| Molecular Structure | ![]() |
| Molecular Formula | C26H14 |
| Molecular Weight | 326.40 |
| CAS Registry Number | 188-89-6 |
| SMILES | C1=CC=C7C6=C1C5=C2C(=CC4=C3C2=C(C=CC3=CC=C4)C=C5)C6=CC=C7 |
| InChI | 1S/C26H14/c1-4-16-10-11-17-12-13-21-19-8-2-5-15-6-3-9-20(24(15)19)22-14-18(7-1)23(16)25(17)26(21)22/h1-14H |
| InChIKey | HLQQSCPDTAIJEZ-UHFFFAOYSA-N |
| Density | 1.392g/cm3 (Cal.) |
|---|---|
| Boiling point | 578.963°C at 760 mmHg (Cal.) |
| Flash point | 298.829°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Naphtho(8,1,2-bcd)Perylene |