Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Naphtho[1,2-a]Anthracene |
|---|---|
| Synonyms | Naphth(1,2-A)Anthracene; 2,3:5,6-Dibenzophenanthrene |
| Molecular Structure | ![CAS#: 195-06-2， Naphtho[1,2-a]Anthracene](/moreStructures/195-06-2.gif) |
| Molecular Formula | C22H14 |
| Molecular Weight | 278.35 |
| CAS Registry Number | 195-06-2 |
| SMILES | C3=C2C=C1C=CC4=C(C1=CC2=CC=C3)C5=C(C=C4)C=CC=C5 |
| InChI | 1S/C22H14/c1-2-7-18-14-21-19(13-17(18)6-1)12-11-16-10-9-15-5-3-4-8-20(15)22(16)21/h1-14H |
| InChIKey | HAJMQPPSPOBCLG-UHFFFAOYSA-N |
| Density | 1.232g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.67°C at 760 mmHg (Cal.) |
| Flash point | 264.522°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Naphtho[1,2-a]Anthracene |