| Nanjing Aribo Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.ariboreagent.com | |||
![]() | +86 19951442182 | |||
![]() | sales@ariboreagent.com | |||
| Chemical manufacturer since 2023 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Classification | Food additive >> Antioxidants |
|---|---|
| Name | (-)-Catechin |
| Synonyms | (2S,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 |
| CAS Registry Number | 18829-70-4 |
| EC Number | 242-611-7 |
| SMILES | C1[C@H]([C@@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)O |
| Solubility | 6.311e+004 mg/L (25 °C water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.742, Calc.* |
| Melting point | 212.09 °C |
| Boiling Point | 498.91 °C, 630.4±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 335.0±31.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H315-H319-H334-H335 Details |
| Safety Statements | P261-P264-P264+P265-P271-P280-P284-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P342+P316-P362+P364-P403+P233-P405-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for (-)-Catechin |