| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | 4-Acetyl-Alfa-Bromohydrocinnamicacid |
|---|---|
| Synonyms | 3-(4-Acetylphenyl)-2-Bromo-Propanoic Acid; 3-(4-Acetylphenyl)-2-Bromo-Propionic Acid; 2-Bromo-3-(4-Ethanoylphenyl)Propanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.11 |
| CAS Registry Number | 18910-19-5 |
| SMILES | C1=CC(=CC=C1CC(Br)C(=O)O)C(C)=O |
| InChI | 1S/C11H11BrO3/c1-7(13)9-4-2-8(3-5-9)6-10(12)11(14)15/h2-5,10H,6H2,1H3,(H,14,15) |
| InChIKey | OTXNYZKECLXPSN-UHFFFAOYSA-N |
| Density | 1.519g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.505°C at 760 mmHg (Cal.) |
| Flash point | 189.366°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Acetyl-Alfa-Bromohydrocinnamicacid |