Online Database of Chemicals from Around the World
|
CAS#: 18930-97-7 Product: 5,6,11,12-Tetrahydrochrysene No suppilers available for the product. |
| Name | 5,6,11,12-Tetrahydrochrysene |
|---|---|
| Synonyms | Chrysene, 5,6,11,12-Tetrahydro- |
| Molecular Structure |  |
| Molecular Formula | C18H16 |
| Molecular Weight | 232.32 |
| CAS Registry Number | 18930-97-7 |
| SMILES | C1=CC=CC4=C1C2=C(C3=C(CC2)C=CC=C3)CC4 |
| InChI | 1S/C18H16/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18/h1-8H,9-12H2 |
| InChIKey | NYZDIQPEOJSBLZ-UHFFFAOYSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.818°C at 760 mmHg (Cal.) |
| Flash point | 198.293°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6,11,12-Tetrahydrochrysene |