Online Database of Chemicals from Around the World
|
CAS#: 81257-94-5 Product: 1,7,8,9-Tetrahydro-5-Chloropyrano(2,3-g)Indole No suppilers available for the product. |
| Name | 1,7,8,9-Tetrahydro-5-Chloropyrano(2,3-g)Indole |
|---|---|
| Synonyms | 1,7,8,9-Tetrahydro-5-Chloropyrano(2,3-G)Indole; 5-Chloro-7,8,9-Trihydro-Pyranno(2,3-G)Indole [French]; Pyrano(2,3-G)Indole, 1,7,8,9-Tetrahydro-5-Chloro- |
| Molecular Structure |  |
| Molecular Formula | C11H10ClNO |
| Molecular Weight | 207.66 |
| CAS Registry Number | 81257-94-5 |
| SMILES | C1=CC2=C([NH]1)C3=C(C(=C2)Cl)OCCC3 |
| InChI | 1S/C11H10ClNO/c12-9-6-7-3-4-13-10(7)8-2-1-5-14-11(8)9/h3-4,6,13H,1-2,5H2 |
| InChIKey | MAWNRTTWMXSRDS-UHFFFAOYSA-N |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.175°C at 760 mmHg (Cal.) |
| Flash point | 196.424°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,7,8,9-Tetrahydro-5-Chloropyrano(2,3-g)Indole |