| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | N-Acetylalanylalanine |
|---|---|
| Synonyms | Ac-Ala-Ala; AC-ALA-ALA-OH; acetylalanylalanine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 |
| CAS Registry Number | 19245-87-5 |
| SMILES | CC(C(=O)NC(C)C(=O)O)NC(=O)C |
| InChI | 1S/C8H14N2O4/c1-4(9-6(3)11)7(12)10-5(2)8(13)14/h4-5H,1-3H3,(H,9,11)(H,10,12)(H,13,14) |
| InChIKey | MJZMSEWWBGCBFM-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 543.6±35.0°C at 760 mmHg (Cal.) |
| Flash point | 282.5±25.9°C (Cal.) |
| Refractive index | 1.482 (Cal.) |
| (1) | Paul D. Thornton and Andreas Heise. Bio-functionalisation to enzymatically control the solution properties of a self-supporting polymeric material, Chem. Commun., 2011, 47, 3108. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-Acetylalanylalanine |