| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Alanine derivatives |
|---|---|
| Name | Acetyl-D-alanyl-D-alanine |
| Synonyms | (2S)-2-[[(2S)-2-Acetamido-1-Oxopropyl]Amino]Propanoic Acid; (2S)-2-[[(2S)-2-Acetamidopropanoyl]Amino]Propionic Acid; Acetyl-Ala-Ala |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 |
| CAS Registry Number | 19993-26-1 |
| SMILES | [C@H](C(=O)O)(NC([C@@H](NC(=O)C)C)=O)C |
| InChI | 1S/C8H14N2O4/c1-4(9-6(3)11)7(12)10-5(2)8(13)14/h4-5H,1-3H3,(H,9,11)(H,10,12)(H,13,14)/t4-,5-/m0/s1 |
| InChIKey | MJZMSEWWBGCBFM-WHFBIAKZSA-N |
| Density | 1.205g/cm3 (Cal.) |
|---|---|
| Boiling point | 543.571°C at 760 mmHg (Cal.) |
| Flash point | 282.542°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Acetyl-D-alanyl-D-alanine |