Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Benzyl (2,6-Dichlorophenyl)Carbamate |
|---|---|
| Synonyms | benzyl (2,6-dichlorophenyl)carbamate; benzyl N-(2,6-dichlorophenyl)carbamate |
| Molecular Structure |  |
| Molecular Formula | C14H11Cl2NO2 |
| Molecular Weight | 296.15 |
| CAS Registry Number | 194874-21-0 |
| SMILES | Clc2cccc(Cl)c2NC(=O)OCc1ccccc1 |
| InChI | 1S/C14H11Cl2NO2/c15-11-7-4-8-12(16)13(11)17-14(18)19-9-10-5-2-1-3-6-10/h1-8H,9H2,(H,17,18) |
| InChIKey | PVCZHYQQUAVGJG-UHFFFAOYSA-N |
| Density | 1.387g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.57°C at 760 mmHg (Cal.) |
| Flash point | 177.31°C (Cal.) |
| Refractive index | 1.636 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzyl (2,6-Dichlorophenyl)Carbamate |