|
CAS#: 90042-88-9 Product: N-Benzyl-2,6-dichloro-4-pyrimidinamine No suppilers available for the product. |
| Name | N-Benzyl-2,6-dichloro-4-pyrimidinamine |
|---|---|
| Synonyms | 4-Pyrimidinamine, 2,6-dichloro-N-(phenylmethyl)-; N-Benzyl-2,6-dichlor-4-pyrimidinamin; N-Benzyl-2,6-dichloro-4-pyrimidinamine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9Cl2N3 |
| Molecular Weight | 254.12 |
| CAS Registry Number | 90042-88-9 |
| SMILES | c1ccc(cc1)CNc2cc(nc(n2)Cl)Cl |
| InChI | 1S/C11H9Cl2N3/c12-9-6-10(16-11(13)15-9)14-7-8-4-2-1-3-5-8/h1-6H,7H2,(H,14,15,16) |
| InChIKey | REGLMDZQHURIFN-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.9±30.0°C at 760 mmHg (Cal.) |
| Flash point | 201.7±24.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Benzyl-2,6-dichloro-4-pyrimidinamine |