Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Name | 9H-Fluorene-9-Thiol |
|---|---|
| Synonyms | Fluorene-9-Thiol; Nsc12360 |
| Molecular Structure |  |
| Molecular Formula | C13H10S |
| Molecular Weight | 198.28 |
| CAS Registry Number | 19552-08-0 |
| SMILES | C1=CC=CC2=C1C(S)C3=C2C=CC=C3 |
| InChI | 1S/C13H10S/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13-14H |
| InChIKey | GNURAXCIBMZJOG-UHFFFAOYSA-N |
| Density | 1.222g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.539°C at 760 mmHg (Cal.) |
| Flash point | 169°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9H-Fluorene-9-Thiol |