Online Database of Chemicals from Around the World
| Name | 9H-Fluoren-9-Imine |
|---|---|
| Synonyms | 9-Fluorenimine; Fluoren-9-Ylideneamine; Fluorenone Ketimine |
| Molecular Structure |  |
| Molecular Formula | C13H9N |
| Molecular Weight | 179.22 |
| CAS Registry Number | 4440-33-9 |
| SMILES | C3=C2C1=C(C=CC=C1)C(C2=CC=C3)=N |
| InChI | 1S/C13H9N/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,14H |
| InChIKey | QVJLOUKVQGQPCX-UHFFFAOYSA-N |
| Density | 1.171g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.365°C at 760 mmHg (Cal.) |
| Flash point | 143.318°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 9H-Fluoren-9-Imine |
