Online Database of Chemicals from Around the World
|
CAS#: 19721-24-5 Product: 1,4,5-Triamino-2,3-Dichloro-8-Hydroxyanthraquinone No suppilers available for the product. |
| Name | 1,4,5-Triamino-2,3-Dichloro-8-Hydroxyanthraquinone |
|---|---|
| Synonyms | 1,4,5-Triamino-2,3-Dichloro-8-Hydroxy-Anthracene-9,10-Dione; 1,4,5-Triamino-2,3-Dichloro-8-Hydroxy-9,10-Anthraquinone; 1,4,5-Triamino-2,3-Dichloro-8-Hydroxyanthraquinone |
| Molecular Structure |  |
| Molecular Formula | C14H9Cl2N3O3 |
| Molecular Weight | 338.15 |
| CAS Registry Number | 19721-24-5 |
| EINECS | 243-251-3 |
| SMILES | C3=C(O)C2=C(C(=O)C1=C(N)C(=C(Cl)C(=C1C2=O)N)Cl)C(=C3)N |
| InChI | 1S/C14H9Cl2N3O3/c15-9-10(16)12(19)8-7(11(9)18)13(21)5-3(17)1-2-4(20)6(5)14(8)22/h1-2,20H,17-19H2 |
| InChIKey | PRRRMBDHOGEKOZ-UHFFFAOYSA-N |
| Density | 1.796g/cm3 (Cal.) |
|---|---|
| Boiling point | 744.66°C at 760 mmHg (Cal.) |
| Flash point | 404.156°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4,5-Triamino-2,3-Dichloro-8-Hydroxyanthraquinone |