Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Triaminoguanidine Mononitrate |
|---|---|
| Synonyms | Triaminoguanidine Mononitrate; Triaminoguanidine Nitrate; Carbonohydrazonic Dihydrazide, Mononitrate |
| Molecular Structure |  |
| Molecular Formula | CH8N7O3 |
| Molecular Weight | 166.12 |
| CAS Registry Number | 4000-16-2 |
| EINECS | 223-647-2 |
| SMILES | O=[N+]([O-])[O-].C(=NN)(NN)NN |
| InChI | 1S/CH8N6.NO3/c2-5-1(6-3)7-4;2-1(3)4/h2-4H2,(H2,5,6,7);/q;-1 |
| InChIKey | ZSZBDKWGCRDYLE-UHFFFAOYSA-N |
| Boiling point | 290.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 129.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Triaminoguanidine Mononitrate |