Online Database of Chemicals from Around the World
| Name | Pentachlorophenyl Dichloroacetate |
|---|---|
| Synonyms | 2,3,4,5,6-Pentachlorophenyl dichloroacetate #; Pentachlorophenyl Dichloroacetate [for Peptide Synthesis]; PENTACHLOROPHENYLDICHLOROACETATE |
| Molecular Structure |  |
| Molecular Formula | C8HCl7O2 |
| Molecular Weight | 377.26 |
| CAS Registry Number | 19745-69-8 |
| SMILES | Clc1c(OC(=O)C(Cl)Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | 1S/C8HCl7O2/c9-1-2(10)4(12)6(5(13)3(1)11)17-8(16)7(14)15/h7H |
| InChIKey | KDDDLTRKFSGKHG-UHFFFAOYSA-N |
| Density | 1.797g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.122°C at 760 mmHg (Cal.) |
| Flash point | 169.583°C (Cal.) |
| Refractive index | 1.599 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Pentachlorophenyl Dichloroacetate |
