Online Database of Chemicals from Around the World
|
CAS#: 70215-07-5 Product: Pentachlorophenylmethyl Sulfoxide No suppilers available for the product. |
| Name | Pentachlorophenylmethyl Sulfoxide |
|---|---|
| Synonyms | 1,2,3,4,5-Pentachloro-6-Methylsulfinyl-Benzene; Benzene, Pentachloro(Methylsulfinyl)-; Pentachloro(Methylsulfinyl)Benzene |
| Molecular Structure |  |
| Molecular Formula | C7H3Cl5OS |
| Molecular Weight | 312.43 |
| CAS Registry Number | 70215-07-5 |
| SMILES | C[S](C1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)=O |
| InChI | 1S/C7H3Cl5OS/c1-14(13)7-5(11)3(9)2(8)4(10)6(7)12/h1H3 |
| InChIKey | NYAOLCQXYFKTGX-UHFFFAOYSA-N |
| Density | 1.81g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.695°C at 760 mmHg (Cal.) |
| Flash point | 217.906°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentachlorophenylmethyl Sulfoxide |