Online Database of Chemicals from Around the World
|
CAS#: 19817-95-9 Product: 1-O-Indol-3-Ylacetylglucose No suppilers available for the product. |
| Name | 1-O-Indol-3-Ylacetylglucose |
|---|---|
| Synonyms | [(2S,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(Hydroxymethyl)Tetrahydropyran-2-Yl] 2-(1H-Indol-3-Yl)Acetate; 2-(1H-Indol-3-Yl)Acetic Acid [(2S,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-(Hydroxymethyl)-2-Tetrahydropyranyl] Ester; 2-(1H-Indol-3-Yl)Acetic Acid [(2S,3R,4S,5S,6R)-3,4,5-Trihydroxy-6-Methylol-Tetrahydropyran-2-Yl] Ester |
| Molecular Structure |  |
| Molecular Formula | C16H19NO7 |
| Molecular Weight | 337.33 |
| CAS Registry Number | 19817-95-9 |
| SMILES | [C@@H]1([C@@H]([C@@H](O)[C@@H]([C@H](O1)CO)O)O)OC(CC2=C[NH]C3=C2C=CC=C3)=O |
| InChI | 1S/C16H19NO7/c18-7-11-13(20)14(21)15(22)16(23-11)24-12(19)5-8-6-17-10-4-2-1-3-9(8)10/h1-4,6,11,13-18,20-22H,5,7H2/t11-,13-,14+,15-,16+/m1/s1 |
| InChIKey | HHDMMUWDSFASNB-JZYAIQKZSA-N |
| Density | 1.548g/cm3 (Cal.) |
|---|---|
| Boiling point | 608.364°C at 760 mmHg (Cal.) |
| Flash point | 321.727°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-O-Indol-3-Ylacetylglucose |