|
CAS#: 2456-73-7 Product: (2S)-2-[[2-(1H-Indol-3-Yl)Acetyl]Amino]Butanedioic Acid No suppilers available for the product. |
| Name | (2S)-2-[[2-(1H-Indol-3-Yl)Acetyl]Amino]Butanedioic Acid |
|---|---|
| Synonyms | (2S)-2-[[2-(1H-Indol-3-Yl)-1-Oxoethyl]Amino]Butanedioic Acid; (2S)-2-[[2-(1H-Indol-3-Yl)Acetyl]Amino]Succinic Acid; (2S)-2-[2-(1H-Indol-3-Yl)Ethanoylamino]Butanedioic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 |
| CAS Registry Number | 2456-73-7 |
| SMILES | [C@H](C(=O)O)(NC(=O)CC1=C[NH]C2=C1C=CC=C2)CC(=O)O |
| InChI | 1S/C14H14N2O5/c17-12(16-11(14(20)21)6-13(18)19)5-8-7-15-10-4-2-1-3-9(8)10/h1-4,7,11,15H,5-6H2,(H,16,17)(H,18,19)(H,20,21)/t11-/m0/s1 |
| InChIKey | VAFNMNRKDDAKRM-NSHDSACASA-N |
| Density | 1.479g/cm3 (Cal.) |
|---|---|
| Boiling point | 641.67°C at 760 mmHg (Cal.) |
| Flash point | 341.87°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2S)-2-[[2-(1H-Indol-3-Yl)Acetyl]Amino]Butanedioic Acid |