Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Florida Center for Heterocyclic Compounds | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (352) 392-0554 | |||
|
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | 2-Naphthyl Formate |
|---|---|
| Synonyms | 2-Naphthyl Formate; Formic Acid 2-Naphthyl Ester; Naphthalen-2-Yl Methanoate |
| Molecular Structure |  |
| Molecular Formula | C11H8O2 |
| Molecular Weight | 172.18 |
| CAS Registry Number | 1988-18-7 |
| EINECS | 217-863-6 |
| SMILES | C1=C2C(=CC=C1OC=O)C=CC=C2 |
| InChI | 1S/C11H8O2/c12-8-13-11-6-5-9-3-1-2-4-10(9)7-11/h1-8H |
| InChIKey | ZSFLPNDWUWXOGM-UHFFFAOYSA-N |
| Density | 1.189g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.15°C at 760 mmHg (Cal.) |
| Flash point | 117.842°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Naphthyl Formate |