Online Database of Chemicals from Around the World
|
CAS#: 906560-16-5 Product: 5-(1-Naphthyl)-2(3H)-furanone No suppilers available for the product. |
| Name | 5-(1-Naphthyl)-2(3H)-furanone |
|---|---|
| Synonyms | 5-(NAPHTHALEN-1-YL)FURAN-2(3H)-ONE; 5-Naphthalen-1-yl-3H-furan-2-one |
| Molecular Structure |  |
| Molecular Formula | C14H10O2 |
| Molecular Weight | 210.23 |
| CAS Registry Number | 906560-16-5 |
| SMILES | c1ccc2c(c1)cccc2C3=CCC(=O)O3 |
| InChI | 1S/C14H10O2/c15-14-9-8-13(16-14)12-7-3-5-10-4-1-2-6-11(10)12/h1-8H,9H2 |
| InChIKey | KSFLWMPJLKCMBH-UHFFFAOYSA-N |
| Density | 1.268g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.178°C at 760 mmHg (Cal.) |
| Flash point | 198.235°C (Cal.) |
| Refractive index | 1.672 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(1-Naphthyl)-2(3H)-furanone |