Online Database of Chemicals from Around the World
|
CAS#: 19897-02-0 Product: 12 alpha-Hydroxyprogesterone No suppilers available for the product. |
| Name | 12 alpha-Hydroxyprogesterone |
|---|---|
| Synonyms | (8R,9S,10R,12S,13S,14S,17S)-17-Ethanoyl-12-Hydroxy-10,13-Dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-Dodecahydrocyclopenta[A]Phenanthren-3-One; C14654; 12Alpha-Hydroxyprogesterone |
| Molecular Structure |  |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 |
| CAS Registry Number | 19897-02-0 |
| SMILES | [C@@H]23CCC1=CC(CC[C@@]1([C@H]2C[C@@H]([C@]4([C@H]3CC[C@@H]4C(=O)C)C)O)C)=O |
| InChI | 1S/C21H30O3/c1-12(22)16-6-7-17-15-5-4-13-10-14(23)8-9-20(13,2)18(15)11-19(24)21(16,17)3/h10,15-19,24H,4-9,11H2,1-3H3/t15-,16+,17-,18-,19-,20-,21+/m0/s1 |
| InChIKey | GBYPMNXBNFQGAV-GCOKGBOCSA-N |
| Density | 1.152g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.423°C at 760 mmHg (Cal.) |
| Flash point | 262.687°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 12 alpha-Hydroxyprogesterone |