Online Database of Chemicals from Around the World
|
CAS#: 596-63-4 Product: 19-Hydroxyprogesterone No suppilers available for the product. |
| Name | 19-Hydroxyprogesterone |
|---|---|
| Synonyms | (8S,9S,10S,13S,14S,17S)-17-Acetyl-13-Methyl-10-Methylol-1,2,6,7,8,9,11,12,14,15,16,17-Dodecahydrocyclopenta[A]Phenanthren-3-One; (8S,9S,10S,13S,14S,17S)-17-Ethanoyl-10-(Hydroxymethyl)-13-Methyl-1,2,6,7,8,9,11,12,14,15,16,17-Dodecahydrocyclopenta[A]Phenanthren-3-One; Zinc04081579 |
| Molecular Structure |  |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 |
| CAS Registry Number | 596-63-4 |
| SMILES | [C@@]34(CO)[C@@H]1[C@H]([C@H]2[C@@](CC1)(C)[C@H](CC2)C(C)=O)CCC3=CC(CC4)=O |
| InChI | 1S/C21H30O3/c1-13(23)17-5-6-18-16-4-3-14-11-15(24)7-10-21(14,12-22)19(16)8-9-20(17,18)2/h11,16-19,22H,3-10,12H2,1-2H3/t16-,17+,18-,19-,20+,21+/m0/s1 |
| InChIKey | FIHWBGCIKMXLBI-NXMWLWCLSA-N |
| Density | 1.154g/cm3 (Cal.) |
|---|---|
| Boiling point | 496.513°C at 760 mmHg (Cal.) |
| Flash point | 268.179°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 19-Hydroxyprogesterone |