Online Database of Chemicals from Around the World
|
CAS#: 20013-55-2 Product: 4'-Methoxy-2-Nitrobiphenyl No suppilers available for the product. |
| Name | 4'-Methoxy-2-Nitrobiphenyl |
|---|---|
| Synonyms | 4'-Methoxy-2-nitrobiphenyl |
| Molecular Structure |  |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 |
| CAS Registry Number | 20013-55-2 |
| SMILES | [O-][N+](=O)c2c(c1ccc(OC)cc1)cccc2 |
| InChI | 1S/C13H11NO3/c1-17-11-8-6-10(7-9-11)12-4-2-3-5-13(12)14(15)16/h2-9H,1H3 |
| InChIKey | IXECOQNNUDDVQY-UHFFFAOYSA-N |
| Density | 1.203g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.977°C at 760 mmHg (Cal.) |
| Flash point | 160.26°C (Cal.) |
| Refractive index | 1.587 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Methoxy-2-Nitrobiphenyl |