Online Database of Chemicals from Around the World
|
CAS#: 92210-60-1 Product: 7-Methoxy-3-nitro-2H-chromene No suppilers available for the product. |
| Name | 7-Methoxy-3-nitro-2H-chromene |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.18 |
| CAS Registry Number | 92210-60-1 |
| SMILES | COc1ccc2c(c1)OCC(=C2)[N+](=O)[O-] |
| InChI | 1S/C10H9NO4/c1-14-9-3-2-7-4-8(11(12)13)6-15-10(7)5-9/h2-5H,6H2,1H3 |
| InChIKey | RKZKWZJLKXVKSQ-UHFFFAOYSA-N |
| Density | 1.344g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.259°C at 760 mmHg (Cal.) |
| Flash point | 168.401°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Methoxy-3-nitro-2H-chromene |