Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3-Methyl-2-(Methylthio)-Benzothiazolium Iodide (1:1) |
|---|---|
| Synonyms | 3-Methyl-2-(Methylthio)-1,3-Benzothiazol-3-Ium Iodide; Benzothiazolium, 3-Methyl-2-Methylthio-, Iodide; 2-Methylmercaptobenzothiazole N-Methiodide |
| Molecular Structure |  |
| Molecular Formula | C9H10INS2 |
| Molecular Weight | 323.21 |
| CAS Registry Number | 20064-98-6 |
| SMILES | C1=CC=CC2=C1SC(=[N+]2C)SC.[I-] |
| InChI | 1S/C9H10NS2.HI/c1-10-7-5-3-4-6-8(7)12-9(10)11-2;/h3-6H,1-2H3;1H/q+1;/p-1 |
| InChIKey | RKIVJTIIEWIWTN-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-2-(Methylthio)-Benzothiazolium Iodide (1:1) |