Online Database of Chemicals from Around the World
|
CAS#: 72187-34-9 Product: 1-[1-Methyl-2-(Methylthio)Ethoxy]-2-Propanol No suppilers available for the product. |
| Name | 1-[1-Methyl-2-(Methylthio)Ethoxy]-2-Propanol |
|---|---|
| Synonyms | (2S)-1-[(1R)-1-Methyl-2-Methylsulfanyl-Ethoxy]Propan-2-Ol; (2S)-1-[(1R)-1-Methyl-2-(Methylthio)Ethoxy]Propan-2-Ol; 2-Propanol, 1-(1-Methyl-2-(Methylthio)Ethoxy)- |
| Molecular Structure | ![CAS#: 72187-34-9， 1-[1-Methyl-2-(Methylthio)Ethoxy]-2-Propanol](/moreStructures/72187-34-9.gif) |
| Molecular Formula | C7H16O2S |
| Molecular Weight | 164.26 |
| CAS Registry Number | 72187-34-9 |
| SMILES | [C@H](OC[C@@H](O)C)(CSC)C |
| InChI | 1S/C7H16O2S/c1-6(8)4-9-7(2)5-10-3/h6-8H,4-5H2,1-3H3/t6-,7+/m0/s1 |
| InChIKey | WYHWTENYOVYBQX-NKWVEPMBSA-N |
| Density | 1.01g/cm3 (Cal.) |
|---|---|
| Boiling point | 250.449°C at 760 mmHg (Cal.) |
| Flash point | 105.268°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[1-Methyl-2-(Methylthio)Ethoxy]-2-Propanol |