| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2-(4-Chlorophenyl)-1,1,1,3,3,3-Hexafluoro-2-Propanol |
|---|---|
| Synonyms | 2-(4-Chlorophenyl)-1,1,1,3,3,3-hexafluoro-2-propanol #; 2-(4-Chlorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol 98%; 2-(4-Chlorophenyl)hexafluoropropan-2-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C9H5ClF6O |
| Molecular Weight | 278.58 |
| CAS Registry Number | 2010-63-1 |
| SMILES | Clc1ccc(cc1)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | 1S/C9H5ClF6O/c10-6-3-1-5(2-4-6)7(17,8(11,12)13)9(14,15)16/h1-4,17H |
| InChIKey | BDVVJTPJVCAQGG-UHFFFAOYSA-N |
| Density | 1.532g/cm3 (Cal.) |
|---|---|
| Boiling point | 253.205°C at 760 mmHg (Cal.) |
| 189-191°C (Expl.) | |
| Flash point | 106.935°C (Cal.) |
| Refractive index | 1.434 (Cal.) |
| Safety Description | Irritant |
|---|---|
| R36/37/38 | |
| S24/25,S36/37/39,S45 | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Chlorophenyl)-1,1,1,3,3,3-Hexafluoro-2-Propanol |