|
CAS#: 65245-23-0 Product: 1-(4-Chlorophenyl)-3a,4,4a,6a,7,7a-Hexahydro-4,7-Methano-1H-[1,2]Diazeto[3,4-f]Benzotriazole No suppilers available for the product. |
| Name | 1-(4-Chlorophenyl)-3a,4,4a,6a,7,7a-Hexahydro-4,7-Methano-1H-[1,2]Diazeto[3,4-f]Benzotriazole |
|---|---|
| Synonyms | 1-(4-Chlorophenyl)-3A,4,4A,6A,7,7A-Hexahydro-4,7-Methano-1H-(1,2)Diazeto(3,4F)Benzotriazole; 4,7-Methano-1H-(1,2)Diazeto(3,4-F)Benzotriazole, 1-(4-Chlorophenyl)-3A,4,4A,6A,7,7A-Hexahydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12ClN5 |
| Molecular Weight | 273.72 |
| CAS Registry Number | 65245-23-0 |
| SMILES | C1=CC(=CC=C1Cl)N5C2C(C3C4C(C2C3)N=N4)N=N5 |
| InChI | 1S/C13H12ClN5/c14-6-1-3-7(4-2-6)19-13-9-5-8(12(13)17-18-19)10-11(9)16-15-10/h1-4,8-13H,5H2 |
| InChIKey | DPOWHSMECVNHAT-UHFFFAOYSA-N |
| Density | 1.979g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.446°C at 760 mmHg (Cal.) |
| Flash point | 200.216°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Chlorophenyl)-3a,4,4a,6a,7,7a-Hexahydro-4,7-Methano-1H-[1,2]Diazeto[3,4-f]Benzotriazole |