| Name | 2-[4-(Trifluoromethyl)Phenyl]Pyridine |
|---|---|
| Synonyms | 2-[4-(Trifluoromethyl)phenyl]pyridine; 4-trifluoromethylphenylpyridine; 4-trifluoromethylphenyl-pyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8F3N |
| Molecular Weight | 223.19 |
| CAS Registry Number | 203065-88-7 |
| SMILES | C1=CC=NC(=C1)C2=CC=C(C=C2)C(F)(F)F |
| InChI | 1S/C12H8F3N/c13-12(14,15)10-6-4-9(5-7-10)11-3-1-2-8-16-11/h1-8H |
| InChIKey | KGZSSIFFYUBVOX-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 77°C (Expl.) |
| Boiling point | 266.4±35.0°C at 760 mmHg (Cal.) |
| Flash point | 114.9±25.9°C (Cal.) |
| Refractive index | 1.506 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Yanling Si, Yuqi Liu, Xiaochun Qu, Ying Wang and Zhijian Wu. Theoretical study on the effect of N-substitution on the electronic structures and photophysical properties of phosphorescent Ir(iii) complexes, Dalton Trans., 2013, . |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-[4-(Trifluoromethyl)Phenyl]Pyridine |