Online Database of Chemicals from Around the World
| Zhengzhou Versailles-special Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (371) 6799-1738 | |||
 |
aurora2074@hotmail.com | |||
| Chemical manufacturer | ||||
| Name | 3-[4-(Trifluoromethyl)Phenyl]Pyridine |
|---|---|
| Synonyms | 3-(4-(Trifluoromethyl)phenyl)pyridine; Pyridine,3-[4-(trifluoromethyl)phenyl]- |
| Molecular Formula | C12H8F3N |
| Molecular Weight | 223.19 |
| CAS Registry Number | 426823-25-8 |
| SMILES | FC(F)(F)c2ccc(c1cccnc1)cc2 |
| InChI | 1S/C12H8F3N/c13-12(14,15)11-5-3-9(4-6-11)10-2-1-7-16-8-10/h1-8H |
| InChIKey | NLEVCXWLTHEKMV-UHFFFAOYSA-N |
| Density | 1.23g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.753°C at 760 mmHg (Cal.) |
| Flash point | 119.966°C (Cal.) |
| Refractive index | 1.506 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[4-(Trifluoromethyl)Phenyl]Pyridine |