Online Database of Chemicals from Around the World
|
CAS#: 20421-10-7 Product: Aflatoxin G2a No suppilers available for the product. |
| Name | Aflatoxin G2a |
|---|---|
| Synonyms | 3,4,7A,9,10,10A-Hexahydro-9-Hydroxy-5-Methoxy-1H,12H-Furo(3',2':4,5)Furo(2,3-H)Pyrano(3,4-C)(1)Benzopyran-1,12-Dione; 5-19-07-00106 (Beilstein Handbook Reference); Aflatoxin G(Sub 2A) |
| Molecular Structure |  |
| Molecular Formula | C17H14O8 |
| Molecular Weight | 346.29 |
| CAS Registry Number | 20421-10-7 |
| EINECS | 243-807-5 |
| SMILES | C1=C5C(=C3C(=C1OC)C2=C(C(OCC2)=O)C(O3)=O)C4C(OC(C4)O)O5 |
| InChI | 1S/C17H14O8/c1-21-8-5-9-12(7-4-10(18)24-17(7)23-9)14-11(8)6-2-3-22-15(19)13(6)16(20)25-14/h5,7,10,17-18H,2-4H2,1H3 |
| InChIKey | PHYKMMVEUJESOM-UHFFFAOYSA-N |
| Density | 1.647g/cm3 (Cal.) |
|---|---|
| Boiling point | 659.401°C at 760 mmHg (Cal.) |
| Flash point | 249.304°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Aflatoxin G2a |