Online Database of Chemicals from Around the World
|
CAS#: 58209-98-6 Product: Aflatoxin B1 Dichloride No suppilers available for the product. |
| Name | Aflatoxin B1 Dichloride |
|---|---|
| Synonyms | Aflatoxin B1 2,3-Dichloride; Aflatoxin B1 Dichloride; Aflatoxin B1-2,3-Dichloride |
| Molecular Structure |  |
| Molecular Formula | C17H12Cl2O6 |
| Molecular Weight | 383.18 |
| CAS Registry Number | 58209-98-6 |
| SMILES | [C@@H]15[C@@H](OC2=C1C3=C(C(=C2)OC)C4=C(C(O3)=O)C(=O)CC4)O[C@@H](Cl)[C@@H]5Cl |
| InChI | 1S/C17H12Cl2O6/c1-22-7-4-8-11(12-13(18)15(19)25-17(12)23-8)14-10(7)5-2-3-6(20)9(5)16(21)24-14/h4,12-13,15,17H,2-3H2,1H3/t12-,13-,15-,17+/m1/s1 |
| InChIKey | SHIWCSLVBGROOU-SMKXDYDZSA-N |
| Density | 1.665g/cm3 (Cal.) |
|---|---|
| Boiling point | 588.121°C at 760 mmHg (Cal.) |
| Flash point | 240.299°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Aflatoxin B1 Dichloride |