Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,2-Dichloronaphthalene |
|---|---|
| Synonyms | Nsc 90290; Naphthalene, 1,2-Dichloro-; Nsc90290 |
| Molecular Structure |  |
| Molecular Formula | C10H6Cl2 |
| Molecular Weight | 197.06 |
| CAS Registry Number | 2050-69-3 |
| EINECS | 218-097-5 |
| SMILES | C1=CC2=C(C=C1)C=CC(=C2Cl)Cl |
| InChI | 1S/C10H6Cl2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H |
| InChIKey | MOXLHAPKZWTHEX-UHFFFAOYSA-N |
| Density | 1.336g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.17°C at 760 mmHg (Cal.) |
| Flash point | 141.555°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dichloronaphthalene |