Online Database of Chemicals from Around the World
| Name | 1,6-Dichloronaphthalene |
|---|---|
| Synonyms | Naphthalene, 1,6-Dichloro- |
| Molecular Structure |  |
| Molecular Formula | C10H6Cl2 |
| Molecular Weight | 197.06 |
| CAS Registry Number | 2050-72-8 |
| EINECS | 218-098-0 |
| SMILES | C1=CC2=C(C=C1Cl)C=CC=C2Cl |
| InChI | 1S/C10H6Cl2/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h1-6H |
| InChIKey | CEDZMDSZTVUPSP-UHFFFAOYSA-N |
| Density | 1.336g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.81°C at 760 mmHg (Cal.) |
| Flash point | 140.479°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,6-Dichloronaphthalene |
