Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 13-cis-Retinol |
|---|---|
| Synonyms | 9-Cis-Retinol; Retinol, 9-Cis-; 13-Cis-Retinol |
| Molecular Structure |  |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 |
| CAS Registry Number | 2052-63-3 |
| SMILES | C(O)\C=C(/C=C/C=C(\C=C\C1=C(CCCC1(C)C)C)C)C |
| InChI | 1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3/b9-6+,12-11+,16-8-,17-13- |
| InChIKey | FPIPGXGPPPQFEQ-BOOMUCAASA-N |
| Density | 0.955g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.248°C at 760 mmHg (Cal.) |
| Flash point | 147.301°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 13-cis-Retinol |